C26H27N3O7 — CID 54589645
5-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole (PubChem CID 54589645) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 54589645 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2=NN(c3ccc([N+](=O)[O-])cc3)C(c3cc(OC)c(OC)c(OC)c3)C2)cc1OC |
| InChI | InChI=1S/C26H27N3O7/c1-32-22-11-6-16(12-23(22)33-2)20-15-21(17-13-24(34-3)26(36-5)25(14-17)35-4)28(27-20)18-7-9-19(10-8-18)29(30)31/h6-14,21H,15H2,1-5H3 |
| InChIKey | MSKIEPAUDYDYJQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 104.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|