C22H18ClN3O3 — CID 118095334
2-(3-chlorophenyl)-5-(2-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazole (PubChem CID 118095334) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-(2-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazole.
| Compound Name | 2-(3-chlorophenyl)-5-(2-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 118095334 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-(3-chlorophenyl)-5-(2-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazole |
| SMILES | COc1ccccc1C1=NN(c2cccc(Cl)c2)C(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H18ClN3O3/c1-29-22-8-3-2-7-19(22)20-14-21(15-9-11-17(12-10-15)26(27)28)25(24-20)18-6-4-5-16(23)13-18/h2-13,21H,14H2,1H3 |
| InChIKey | GLVIIRMLKSPQEU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|