C18H16ClN3O2 — CID 118095323
2-(3-chlorophenyl)-5-cyclopropyl-3-(4-nitrophenyl)-3,4-dihydropyrazole (PubChem CID 118095323) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-cyclopropyl-3-(4-nitrophenyl)-3,4-dihydropyrazole.
| Compound Name | 2-(3-chlorophenyl)-5-cyclopropyl-3-(4-nitrophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 118095323 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-(3-chlorophenyl)-5-cyclopropyl-3-(4-nitrophenyl)-3,4-dihydropyrazole |
| SMILES | O=[N+]([O-])c1ccc(C2CC(C3CC3)=NN2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H16ClN3O2/c19-14-2-1-3-16(10-14)21-18(11-17(20-21)12-4-5-12)13-6-8-15(9-7-13)22(23)24/h1-3,6-10,12,18H,4-5,11H2 |
| InChIKey | XWXLCXRMLXMWNK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|