C22H19N3O3 — CID 7431710
(3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazole (PubChem CID 7431710) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is (3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazole.
| Compound Name | (3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 7431710 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2=NN(c3ccccc3)[C@@H](c3cccc([N+](=O)[O-])c3)C2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c1-28-20-12-10-16(11-13-20)21-15-22(17-6-5-9-19(14-17)25(26)27)24(23-21)18-7-3-2-4-8-18/h2-14,22H,15H2,1H3/t22-/m1/s1 |
| InChIKey | NWBGGRJWENBGAN-JOCHJYFZSA-N |
| XLogP | 4.96 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|