C28H22N4O2 — CID 40901413
1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(3-nitrophenyl)methanimine (PubChem CID 40901413) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(3-nitrophenyl)methanimine.
| Compound Name | 1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 40901413 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(3-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(/N=C/c2ccc(N3N=C(c4ccccc4)C[C@H]3c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H22N4O2/c33-32(34)26-13-7-12-24(18-26)29-20-21-14-16-25(17-15-21)31-28(23-10-5-2-6-11-23)19-27(30-31)22-8-3-1-4-9-22/h1-18,20,28H,19H2/b29-20+/t28-/m0/s1 |
| InChIKey | VMSSRFACACSPJK-YXCSQOMQSA-N |
| XLogP | 6.70 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|