C20H18N3O6- — CID 6958829
4-[(3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate (PubChem CID 6958829) has the molecular formula C20H18N3O6- and a molecular weight of 396.38 g/mol. Its IUPAC name is 4-[(3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate.
| Compound Name | 4-[(3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 6958829 |
| Molecular Formula | C20H18N3O6- |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-[(3R)-5-(4-methoxyphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate |
| SMILES | COc1ccc(C2=NN(C(=O)CCC(=O)[O-])[C@@H](c3cccc([N+](=O)[O-])c3)C2)cc1 |
| InChI | InChI=1S/C20H19N3O6/c1-29-16-7-5-13(6-8-16)17-12-18(14-3-2-4-15(11-14)23(27)28)22(21-17)19(24)9-10-20(25)26/h2-8,11,18H,9-10,12H2,1H3,(H,25,26)/p-1/t18-/m1/s1 |
| InChIKey | BWDNJAUUIINZMS-GOSISDBHSA-M |
| XLogP | 1.81 |
| TPSA | 125.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|