C20H19N5O6 — CID 93130322
N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]propanamide (PubChem CID 93130322) has the molecular formula C20H19N5O6 and a molecular weight of 425.40 g/mol. Its IUPAC name is N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]propanamide.
| Compound Name | N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 93130322 |
| Molecular Formula | C20H19N5O6 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]propanamide |
| SMILES | CCC(=O)NCC(=O)N1N=C(c2ccc([N+](=O)[O-])cc2)C[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N5O6/c1-2-19(26)21-12-20(27)23-18(14-4-3-5-16(10-14)25(30)31)11-17(22-23)13-6-8-15(9-7-13)24(28)29/h3-10,18H,2,11-12H2,1H3,(H,21,26)/t18-/m0/s1 |
| InChIKey | RHQPFWHTKZBXGX-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|