C28H27N5O8 — CID 98424852
4-methoxy-N-(2-methoxyethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide (PubChem CID 98424852) has the molecular formula C28H27N5O8 and a molecular weight of 561.55 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 98424852 |
| Molecular Formula | C28H27N5O8 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide |
| SMILES | COCCN(CC(=O)N1N=C(c2ccc([N+](=O)[O-])cc2)C[C@H]1c1cccc([N+](=O)[O-])c1)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H27N5O8/c1-40-15-14-30(28(35)20-8-12-24(41-2)13-9-20)18-27(34)31-26(21-4-3-5-23(16-21)33(38)39)17-25(29-31)19-6-10-22(11-7-19)32(36)37/h3-13,16,26H,14-15,17-18H2,1-2H3/t26-/m0/s1 |
| InChIKey | AYJQTYNSWOOEHU-SANMLTNESA-N |
| XLogP | 3.98 |
| TPSA | 157.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|