C24H25FN4O5 — CID 93129653
N-[2-[(3R)-5-(4-fluorophenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-N-(2-methoxyethyl)cyclopropanecarboxamide (PubChem CID 93129653) has the molecular formula C24H25FN4O5 and a molecular weight of 468.49 g/mol. Its IUPAC name is N-[2-[(3R)-5-(4-fluorophenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-N-(2-methoxyethyl)cyclopropanecarboxamide.
| Compound Name | N-[2-[(3R)-5-(4-fluorophenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-N-(2-methoxyethyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 93129653 |
| Molecular Formula | C24H25FN4O5 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-[2-[(3R)-5-(4-fluorophenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-N-(2-methoxyethyl)cyclopropanecarboxamide |
| SMILES | COCCN(CC(=O)N1N=C(c2ccc(F)cc2)C[C@@H]1c1cccc([N+](=O)[O-])c1)C(=O)C1CC1 |
| InChI | InChI=1S/C24H25FN4O5/c1-34-12-11-27(24(31)17-5-6-17)15-23(30)28-22(18-3-2-4-20(13-18)29(32)33)14-21(26-28)16-7-9-19(25)10-8-16/h2-4,7-10,13,17,22H,5-6,11-12,14-15H2,1H3/t22-/m1/s1 |
| InChIKey | QDGORXZOWFYRCK-JOCHJYFZSA-N |
| XLogP | 3.30 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|