C25H23FN4O5S — CID 93129193
3-fluoro-N-(2-methoxyethyl)-N-[2-[(3R)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide (PubChem CID 93129193) has the molecular formula C25H23FN4O5S and a molecular weight of 510.55 g/mol. Its IUPAC name is 3-fluoro-N-(2-methoxyethyl)-N-[2-[(3R)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide.
| Compound Name | 3-fluoro-N-(2-methoxyethyl)-N-[2-[(3R)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93129193 |
| Molecular Formula | C25H23FN4O5S |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 3-fluoro-N-(2-methoxyethyl)-N-[2-[(3R)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide |
| SMILES | COCCN(CC(=O)N1N=C(c2cccs2)C[C@@H]1c1cccc([N+](=O)[O-])c1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C25H23FN4O5S/c1-35-11-10-28(25(32)18-6-2-7-19(26)13-18)16-24(31)29-22(15-21(27-29)23-9-4-12-36-23)17-5-3-8-20(14-17)30(33)34/h2-9,12-14,22H,10-11,15-16H2,1H3/t22-/m1/s1 |
| InChIKey | VVNCBCIIVXRAOM-JOCHJYFZSA-N |
| XLogP | 4.26 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|