C28H28ClN5O5S — CID 98409091
2-chloro-N-(2-morpholin-4-ylethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide (PubChem CID 98409091) has the molecular formula C28H28ClN5O5S and a molecular weight of 582.08 g/mol. Its IUPAC name is 2-chloro-N-(2-morpholin-4-ylethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-(2-morpholin-4-ylethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 98409091 |
| Molecular Formula | C28H28ClN5O5S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 2-chloro-N-(2-morpholin-4-ylethyl)-N-[2-[(3S)-3-(3-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(c1ccccc1Cl)N(CCN1CCOCC1)CC(=O)N1N=C(c2cccs2)C[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H28ClN5O5S/c29-23-8-2-1-7-22(23)28(36)32(11-10-31-12-14-39-15-13-31)19-27(35)33-25(18-24(30-33)26-9-4-16-40-26)20-5-3-6-21(17-20)34(37)38/h1-9,16-17,25H,10-15,18-19H2/t25-/m0/s1 |
| InChIKey | IIXQFFAPLUKKJP-VWLOTQADSA-N |
| XLogP | 4.46 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|