C26H26N4O7 — CID 93132182
N-(2-methoxyethyl)-N-[2-[(3S)-3-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 93132182) has the molecular formula C26H26N4O7 and a molecular weight of 506.52 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[2-[(3S)-3-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-[2-[(3S)-3-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 93132182 |
| Molecular Formula | C26H26N4O7 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-(2-methoxyethyl)-N-[2-[(3S)-3-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | COCCN(CC(=O)N1N=C(c2ccc([N+](=O)[O-])cc2)C[C@H]1c1ccc(OC)cc1)C(=O)c1ccco1 |
| InChI | InChI=1S/C26H26N4O7/c1-35-15-13-28(26(32)24-4-3-14-37-24)17-25(31)29-23(19-7-11-21(36-2)12-8-19)16-22(27-29)18-5-9-20(10-6-18)30(33)34/h3-12,14,23H,13,15-17H2,1-2H3/t23-/m0/s1 |
| InChIKey | JDZQHWDHDYBSBU-QHCPKHFHSA-N |
| XLogP | 3.66 |
| TPSA | 127.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|