C23H23N5O6 — CID 93130324
N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]cyclopentanecarboxamide (PubChem CID 93130324) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 93130324 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-[2-[(3S)-3-(3-nitrophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCC(=O)N1N=C(c2ccc([N+](=O)[O-])cc2)C[C@H]1c1cccc([N+](=O)[O-])c1)C1CCCC1 |
| InChI | InChI=1S/C23H23N5O6/c29-22(14-24-23(30)16-4-1-2-5-16)26-21(17-6-3-7-19(12-17)28(33)34)13-20(25-26)15-8-10-18(11-9-15)27(31)32/h3,6-12,16,21H,1-2,4-5,13-14H2,(H,24,30)/t21-/m0/s1 |
| InChIKey | FHMDTKLQMQKTPG-NRFANRHFSA-N |
| XLogP | 3.49 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|