C23H18N4O6 — CID 40653516
[(3R)-5-(4-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone (PubChem CID 40653516) has the molecular formula C23H18N4O6 and a molecular weight of 446.42 g/mol. Its IUPAC name is [(3R)-5-(4-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(3R)-5-(4-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 40653516 |
| Molecular Formula | C23H18N4O6 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [(3R)-5-(4-methoxyphenyl)-3-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1ccc(C2=NN(C(=O)c3cccc([N+](=O)[O-])c3)[C@@H](c3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C23H18N4O6/c1-33-20-11-7-15(8-12-20)21-14-22(16-5-9-18(10-6-16)26(29)30)25(24-21)23(28)17-3-2-4-19(13-17)27(31)32/h2-13,22H,14H2,1H3/t22-/m1/s1 |
| InChIKey | SEVFJMYFKIJJJA-JOCHJYFZSA-N |
| XLogP | 4.50 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|