C23H18BrN3O4 — CID 4073095
[5-(4-bromophenyl)-3-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone (PubChem CID 4073095) has the molecular formula C23H18BrN3O4 and a molecular weight of 480.32 g/mol. Its IUPAC name is [5-(4-bromophenyl)-3-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone.
| Compound Name | [5-(4-bromophenyl)-3-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 4073095 |
| Molecular Formula | C23H18BrN3O4 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | [5-(4-bromophenyl)-3-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1ccccc1C1CC(c2ccc(Br)cc2)=NN1C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18BrN3O4/c1-31-22-8-3-2-7-19(22)21-14-20(15-9-11-17(24)12-10-15)25-26(21)23(28)16-5-4-6-18(13-16)27(29)30/h2-13,21H,14H2,1H3 |
| InChIKey | IWZPYVWXMYTTMZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|