C22H16Br2N2O — CID 3098588
[3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone (PubChem CID 3098588) has the molecular formula C22H16Br2N2O and a molecular weight of 484.19 g/mol. Its IUPAC name is [3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone.
| Compound Name | [3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 3098588 |
| Molecular Formula | C22H16Br2N2O |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | [3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1N=C(c2ccc(Br)cc2)CC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H16Br2N2O/c23-18-10-6-15(7-11-18)20-14-21(16-8-12-19(24)13-9-16)26(25-20)22(27)17-4-2-1-3-5-17/h1-13,21H,14H2 |
| InChIKey | PEABRZQMSMBRPV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |