C24H21Br2N3O — CID 98144329
(2-bromophenyl)-[(3R)-5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 98144329) has the molecular formula C24H21Br2N3O and a molecular weight of 527.26 g/mol. Its IUPAC name is (2-bromophenyl)-[(3R)-5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | (2-bromophenyl)-[(3R)-5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 98144329 |
| Molecular Formula | C24H21Br2N3O |
| Molecular Weight | 527.26 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | (2-bromophenyl)-[(3R)-5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | CN(C)c1ccc([C@H]2CC(c3ccc(Br)cc3)=NN2C(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C24H21Br2N3O/c1-28(2)19-13-9-17(10-14-19)23-15-22(16-7-11-18(25)12-8-16)27-29(23)24(30)20-5-3-4-6-21(20)26/h3-14,23H,15H2,1-2H3/t23-/m1/s1 |
| InChIKey | MCJZNKVKRBQLRP-HSZRJFAPSA-N |
| XLogP | 6.27 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.26 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|