C26H24BrN3O — CID 3738757
1-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 3738757) has the molecular formula C26H24BrN3O and a molecular weight of 474.40 g/mol. Its IUPAC name is 1-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 3738757 |
| Molecular Formula | C26H24BrN3O |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 1-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | CN(C)c1ccc(C2CC(c3ccc(Br)cc3)=NN2C(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24BrN3O/c1-29(2)23-15-11-21(12-16-23)25-18-24(20-9-13-22(27)14-10-20)28-30(25)26(31)17-8-19-6-4-3-5-7-19/h3-17,25H,18H2,1-2H3 |
| InChIKey | NYTSLFJDMFHKHZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|