C25H21FN2O2 — CID 7390968
(E)-1-[(3R)-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 7390968) has the molecular formula C25H21FN2O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is (E)-1-[(3R)-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 7390968 |
| Molecular Formula | C25H21FN2O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (E)-1-[(3R)-3-(4-fluorophenyl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | COc1ccc(C2=NN(C(=O)/C=C/c3ccccc3)[C@@H](c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C25H21FN2O2/c1-30-22-14-10-19(11-15-22)23-17-24(20-8-12-21(26)13-9-20)28(27-23)25(29)16-7-18-5-3-2-4-6-18/h2-16,24H,17H2,1H3/b16-7+/t24-/m1/s1 |
| InChIKey | DMRIZUFQZAUORJ-XTXDOFFSSA-N |
| XLogP | 5.23 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|