C24H19FN2O — CID 126796107
1-[5-(4-fluorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 126796107) has the molecular formula C24H19FN2O and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[5-(4-fluorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 126796107 |
| Molecular Formula | C24H19FN2O |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)N1N=C(c2ccc(F)cc2)CC1c1ccccc1 |
| InChI | InChI=1S/C24H19FN2O/c25-21-14-12-19(13-15-21)22-17-23(20-9-5-2-6-10-20)27(26-22)24(28)16-11-18-7-3-1-4-8-18/h1-16,23H,17H2 |
| InChIKey | NNPXQPOOTVDCBI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|