C30H24N2O3 — CID 5009483
[2-[3-phenyl-2-(3-phenylprop-2-enoyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate (PubChem CID 5009483) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is [2-[3-phenyl-2-(3-phenylprop-2-enoyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate.
| Compound Name | [2-[3-phenyl-2-(3-phenylprop-2-enoyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 5009483 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [2-[3-phenyl-2-(3-phenylprop-2-enoyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C2=NN(C(=O)C=Cc3ccccc3)C(c3ccccc3)C2)ccc2ccccc12 |
| InChI | InChI=1S/C30H24N2O3/c1-21(33)35-30-25-15-9-8-12-23(25)17-18-26(30)27-20-28(24-13-6-3-7-14-24)32(31-27)29(34)19-16-22-10-4-2-5-11-22/h2-19,28H,20H2,1H3 |
| InChIKey | CLBDJSSKSHESDI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|