C30H26N2O5 — CID 2955016
[2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate (PubChem CID 2955016) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is [2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate.
| Compound Name | [2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 2955016 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate |
| SMILES | COc1ccc(C2CC(c3ccc4ccccc4c3OC(C)=O)=NN2C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H26N2O5/c1-19(33)37-29-23-12-8-7-9-20(23)13-15-24(29)25-18-26(22-14-16-27(35-2)28(17-22)36-3)32(31-25)30(34)21-10-5-4-6-11-21/h4-17,26H,18H2,1-3H3 |
| InChIKey | LRXSXLVMWGNOAV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|