C32H28N2O6 — CID 3278568
[2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate (PubChem CID 3278568) has the molecular formula C32H28N2O6 and a molecular weight of 536.58 g/mol. Its IUPAC name is [2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate.
| Compound Name | [2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 3278568 |
| Molecular Formula | C32H28N2O6 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | [2-[2-benzoyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccccc3)C(c3ccc(OC)c(OC)c3)C2)c(OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C32H28N2O6/c1-37-24-15-16-25(29(19-24)40-32(36)22-12-8-5-9-13-22)26-20-27(23-14-17-28(38-2)30(18-23)39-3)34(33-26)31(35)21-10-6-4-7-11-21/h4-19,27H,20H2,1-3H3 |
| InChIKey | ZBSCQHJPWOLOPE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|