C30H24N2O4 — CID 3253484
[2-[2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl] benzoate (PubChem CID 3253484) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is [2-[2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl] benzoate.
| Compound Name | [2-[2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 3253484 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [2-[2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl] benzoate |
| SMILES | COc1ccc(C2CC(c3ccccc3OC(=O)c3ccccc3)=NN2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2O4/c1-35-24-18-16-21(17-19-24)27-20-26(31-32(27)29(33)22-10-4-2-5-11-22)25-14-8-9-15-28(25)36-30(34)23-12-6-3-7-13-23/h2-19,27H,20H2,1H3 |
| InChIKey | YAGGDKMAYIAIDR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|