C30H23ClN2O4 — CID 41064883
[2-[(3R)-2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate (PubChem CID 41064883) has the molecular formula C30H23ClN2O4 and a molecular weight of 510.98 g/mol. Its IUPAC name is [2-[(3R)-2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate.
| Compound Name | [2-[(3R)-2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate |
|---|---|
| PubChem CID | 41064883 |
| Molecular Formula | C30H23ClN2O4 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | [2-[(3R)-2-benzoyl-3-(4-methoxyphenyl)-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate |
| SMILES | COc1ccc([C@H]2CC(c3cc(Cl)ccc3OC(=O)c3ccccc3)=NN2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H23ClN2O4/c1-36-24-15-12-20(13-16-24)27-19-26(32-33(27)29(34)21-8-4-2-5-9-21)25-18-23(31)14-17-28(25)37-30(35)22-10-6-3-7-11-22/h2-18,27H,19H2,1H3/t27-/m1/s1 |
| InChIKey | AHKZBOLXDCPKJM-HHHXNRCGSA-N |
| XLogP | 6.56 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|