About [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate
[2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate (PubChem CID 2956794) has the molecular formula C27H26N2O6
and a molecular weight of 474.51 g/mol. Its IUPAC name is [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate.
Molecular Properties
| Compound Name | [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate |
| PubChem CID | 2956794 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate |
| SMILES | COc1ccc(C2=NN(C(C)=O)C(c3ccc(OC)c(OC)c3)C2)c(OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H26N2O6/c1-17(30)29-23(19-10-13-24(33-3)26(14-19)34-4)16-22(28-29)21-12-11-20(32-2)15-25(21)35-27(31)18-8-6-5-7-9-18/h5-15,23H,16H2,1-4H3 |
| InChIKey | MVHUPWDAOOTSLO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate?
The IUPAC name of [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate (CID 2956794) is [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate.
What is the SMILES notation for [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate?
The canonical SMILES for [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate is COc1ccc(C2=NN(C(C)=O)C(c3ccc(OC)c(OC)c3)C2)c(OC(=O)c2ccccc2)c1.
What is the InChIKey of [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate?
The InChIKey is MVHUPWDAOOTSLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O6/c1-17(30)29-23(19-10-13-24(33-3)26(14-19)34-4)16-22(28-29)21-12-11-20(32-2)15-25(21)35-27(31)18-8-6-5-7-9-18/h5-15,23H,16H2,1-4H3.
What are the key properties of [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate?
[2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate has a molecular weight of 474.51 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate is sourced from PubChem (CID 2956794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).