C27H26N2O6 — CID 2956794
[2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate (PubChem CID 2956794) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate.
| Compound Name | [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 2956794 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [2-[2-acetyl-3-(3,4-dimethoxyphenyl)-3,4-dihydropyrazol-5-yl]-5-methoxyphenyl] benzoate |
| SMILES | COc1ccc(C2=NN(C(C)=O)C(c3ccc(OC)c(OC)c3)C2)c(OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H26N2O6/c1-17(30)29-23(19-10-13-24(33-3)26(14-19)34-4)16-22(28-29)21-12-11-20(32-2)15-25(21)35-27(31)18-8-6-5-7-9-18/h5-15,23H,16H2,1-4H3 |
| InChIKey | MVHUPWDAOOTSLO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|