C29H21ClN2O3 — CID 41064878
[2-[(3S)-2-benzoyl-3-phenyl-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate (PubChem CID 41064878) has the molecular formula C29H21ClN2O3 and a molecular weight of 480.95 g/mol. Its IUPAC name is [2-[(3S)-2-benzoyl-3-phenyl-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate.
| Compound Name | [2-[(3S)-2-benzoyl-3-phenyl-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate |
|---|---|
| PubChem CID | 41064878 |
| Molecular Formula | C29H21ClN2O3 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | [2-[(3S)-2-benzoyl-3-phenyl-3,4-dihydropyrazol-5-yl]-4-chlorophenyl] benzoate |
| SMILES | O=C(Oc1ccc(Cl)cc1C1=NN(C(=O)c2ccccc2)[C@H](c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C29H21ClN2O3/c30-23-16-17-27(35-29(34)22-14-8-3-9-15-22)24(18-23)25-19-26(20-10-4-1-5-11-20)32(31-25)28(33)21-12-6-2-7-13-21/h1-18,26H,19H2/t26-/m0/s1 |
| InChIKey | RQGMAMLLXRGUMV-SANMLTNESA-N |
| XLogP | 6.55 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|