About [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate
[2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate (PubChem CID 4916471) has the molecular formula C33H22Cl2N2O3
and a molecular weight of 565.46 g/mol. Its IUPAC name is [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate.
Molecular Properties
| Compound Name | [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate |
| PubChem CID | 4916471 |
| Molecular Formula | C33H22Cl2N2O3 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate |
| SMILES | O=C(Oc1c(C2=NN(C(=O)c3ccccc3)C(c3ccc(Cl)cc3Cl)C2)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C33H22Cl2N2O3/c34-24-16-18-26(28(35)19-24)30-20-29(36-37(30)32(38)22-10-3-1-4-11-22)27-17-15-21-9-7-8-14-25(21)31(27)40-33(39)23-12-5-2-6-13-23/h1-19,30H,20H2 |
| InChIKey | YNTDCTUZHQBOGH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate?
The IUPAC name of [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate (CID 4916471) is [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate.
What is the SMILES notation for [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate?
The canonical SMILES for [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate is O=C(Oc1c(C2=NN(C(=O)c3ccccc3)C(c3ccc(Cl)cc3Cl)C2)ccc2ccccc12)c1ccccc1.
What is the InChIKey of [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate?
The InChIKey is YNTDCTUZHQBOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H22Cl2N2O3/c34-24-16-18-26(28(35)19-24)30-20-29(36-37(30)32(38)22-10-3-1-4-11-22)27-17-15-21-9-7-8-14-25(21)31(27)40-33(39)23-12-5-2-6-13-23/h1-19,30H,20H2.
What are the key properties of [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate?
[2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate has a molecular weight of 565.46 g/mol, XLogP of 8.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-benzoyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] benzoate is sourced from PubChem (CID 4916471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).