C28H24ClN3O4 — CID 97063903
[(3R)-3-(2-chloro-6-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone (PubChem CID 97063903) has the molecular formula C28H24ClN3O4 and a molecular weight of 501.97 g/mol. Its IUPAC name is [(3R)-3-(2-chloro-6-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone.
| Compound Name | [(3R)-3-(2-chloro-6-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 97063903 |
| Molecular Formula | C28H24ClN3O4 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | [(3R)-3-(2-chloro-6-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccccc3)[C@@H](c3cc4cc(OC)ccc4nc3Cl)C2)c(OC)c1 |
| InChI | InChI=1S/C28H24ClN3O4/c1-34-19-10-12-23-18(13-19)14-22(27(29)30-23)25-16-24(21-11-9-20(35-2)15-26(21)36-3)31-32(25)28(33)17-7-5-4-6-8-17/h4-15,25H,16H2,1-3H3/t25-/m1/s1 |
| InChIKey | QJASYTOHEVLGLT-RUZDIDTESA-N |
| XLogP | 5.91 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|