C25H24ClN3O6 — CID 71844148
4-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid (PubChem CID 71844148) has the molecular formula C25H24ClN3O6 and a molecular weight of 497.94 g/mol. Its IUPAC name is 4-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71844148 |
| Molecular Formula | C25H24ClN3O6 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 4-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(2,4-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
| SMILES | COc1ccc(C2=NN(C(=O)CCC(=O)O)C(c3cc4ccc(OC)cc4nc3Cl)C2)c(OC)c1 |
| InChI | InChI=1S/C25H24ClN3O6/c1-33-15-5-4-14-10-18(25(26)27-19(14)11-15)21-13-20(28-29(21)23(30)8-9-24(31)32)17-7-6-16(34-2)12-22(17)35-3/h4-7,10-12,21H,8-9,13H2,1-3H3,(H,31,32) |
| InChIKey | HUYCFVBKGMHDRY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|