C24H21ClFN3O4 — CID 96533978
4-[(3R)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid (PubChem CID 96533978) has the molecular formula C24H21ClFN3O4 and a molecular weight of 469.90 g/mol. Its IUPAC name is 4-[(3R)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(3R)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 96533978 |
| Molecular Formula | C24H21ClFN3O4 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 4-[(3R)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
| SMILES | CCOc1ccc2cc([C@H]3CC(c4ccc(F)cc4)=NN3C(=O)CCC(=O)O)c(Cl)nc2c1 |
| InChI | InChI=1S/C24H21ClFN3O4/c1-2-33-17-8-5-15-11-18(24(25)27-19(15)12-17)21-13-20(14-3-6-16(26)7-4-14)28-29(21)22(30)9-10-23(31)32/h3-8,11-12,21H,2,9-10,13H2,1H3,(H,31,32)/t21-/m1/s1 |
| InChIKey | YIJYQSXOPJJCSG-OAQYLSRUSA-N |
| XLogP | 4.97 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|