C26H25ClIN3O4 — CID 155903582
6-[3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(3-iodophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid (PubChem CID 155903582) has the molecular formula C26H25ClIN3O4 and a molecular weight of 605.86 g/mol. Its IUPAC name is 6-[3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(3-iodophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid.
| Compound Name | 6-[3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(3-iodophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 155903582 |
| Molecular Formula | C26H25ClIN3O4 |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.06 |
| IUPAC Name | 6-[3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(3-iodophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid |
| SMILES | CCOc1ccc2cc(C3CC(c4cccc(I)c4)=NN3C(=O)CCCCC(=O)O)c(Cl)nc2c1 |
| InChI | InChI=1S/C26H25ClIN3O4/c1-2-35-19-11-10-17-13-20(26(27)29-21(17)14-19)23-15-22(16-6-5-7-18(28)12-16)30-31(23)24(32)8-3-4-9-25(33)34/h5-7,10-14,23H,2-4,8-9,15H2,1H3,(H,33,34) |
| InChIKey | CPIMEEJKEMFINC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|