C25H23BrClN3O4 — CID 98144999
5-[(3R)-5-(3-bromophenyl)-3-(2-chloro-7-ethoxyquinolin-3-yl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid (PubChem CID 98144999) has the molecular formula C25H23BrClN3O4 and a molecular weight of 544.83 g/mol. Its IUPAC name is 5-[(3R)-5-(3-bromophenyl)-3-(2-chloro-7-ethoxyquinolin-3-yl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-[(3R)-5-(3-bromophenyl)-3-(2-chloro-7-ethoxyquinolin-3-yl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 98144999 |
| Molecular Formula | C25H23BrClN3O4 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | 5-[(3R)-5-(3-bromophenyl)-3-(2-chloro-7-ethoxyquinolin-3-yl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
| SMILES | CCOc1ccc2cc([C@H]3CC(c4cccc(Br)c4)=NN3C(=O)CCCC(=O)O)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H23BrClN3O4/c1-2-34-18-10-9-16-12-19(25(27)28-20(16)13-18)22-14-21(15-5-3-6-17(26)11-15)29-30(22)23(31)7-4-8-24(32)33/h3,5-6,9-13,22H,2,4,7-8,14H2,1H3,(H,32,33)/t22-/m1/s1 |
| InChIKey | AFPUVVPZZYQBCW-JOCHJYFZSA-N |
| XLogP | 5.98 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|