C26H26ClN3O6 — CID 86820229
5-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3,5-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid (PubChem CID 86820229) has the molecular formula C26H26ClN3O6 and a molecular weight of 511.96 g/mol. Its IUPAC name is 5-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3,5-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3,5-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 86820229 |
| Molecular Formula | C26H26ClN3O6 |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 5-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3,5-dimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
| SMILES | COc1cc(OC)cc(C2=NN(C(=O)CCCC(=O)O)C(c3cc4cccc(OC)c4nc3Cl)C2)c1 |
| InChI | InChI=1S/C26H26ClN3O6/c1-34-17-10-16(11-18(13-17)35-2)20-14-21(30(29-20)23(31)8-5-9-24(32)33)19-12-15-6-4-7-22(36-3)25(15)28-26(19)27/h4,6-7,10-13,21H,5,8-9,14H2,1-3H3,(H,32,33) |
| InChIKey | SAPGITXGCHVGDQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|