C25H23ClFN3O4 — CID 155903578
6-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid (PubChem CID 155903578) has the molecular formula C25H23ClFN3O4 and a molecular weight of 483.93 g/mol. Its IUPAC name is 6-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid.
| Compound Name | 6-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 155903578 |
| Molecular Formula | C25H23ClFN3O4 |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 6-[3-(2-chloro-7-methoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-6-oxohexanoic acid |
| SMILES | COc1ccc2cc(C3CC(c4ccc(F)cc4)=NN3C(=O)CCCCC(=O)O)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H23ClFN3O4/c1-34-18-11-8-16-12-19(25(26)28-20(16)13-18)22-14-21(15-6-9-17(27)10-7-15)29-30(22)23(31)4-2-3-5-24(32)33/h6-13,22H,2-5,14H2,1H3,(H,32,33) |
| InChIKey | WWQNSAQMGZIZFS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|