C23H21ClFN3O2 — CID 96533971
1-[(3S)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one (PubChem CID 96533971) has the molecular formula C23H21ClFN3O2 and a molecular weight of 425.89 g/mol. Its IUPAC name is 1-[(3S)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one.
| Compound Name | 1-[(3S)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 96533971 |
| Molecular Formula | C23H21ClFN3O2 |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-[(3S)-3-(2-chloro-7-ethoxyquinolin-3-yl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one |
| SMILES | CCOc1ccc2cc([C@@H]3CC(c4ccc(F)cc4)=NN3C(=O)CC)c(Cl)nc2c1 |
| InChI | InChI=1S/C23H21ClFN3O2/c1-3-22(29)28-21(13-20(27-28)14-5-8-16(25)9-6-14)18-11-15-7-10-17(30-4-2)12-19(15)26-23(18)24/h5-12,21H,3-4,13H2,1-2H3/t21-/m0/s1 |
| InChIKey | CWFAMURIWMCQIM-NRFANRHFSA-N |
| XLogP | 5.51 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|