C24H22ClN3O5 — CID 132587451
4-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid (PubChem CID 132587451) has the molecular formula C24H22ClN3O5 and a molecular weight of 467.91 g/mol. Its IUPAC name is 4-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 132587451 |
| Molecular Formula | C24H22ClN3O5 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 4-[3-(2-chloro-8-methoxyquinolin-3-yl)-5-(2-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
| SMILES | COc1ccccc1C1=NN(C(=O)CCC(=O)O)C(c2cc3cccc(OC)c3nc2Cl)C1 |
| InChI | InChI=1S/C24H22ClN3O5/c1-32-19-8-4-3-7-15(19)17-13-18(28(27-17)21(29)10-11-22(30)31)16-12-14-6-5-9-20(33-2)23(14)26-24(16)25/h3-9,12,18H,10-11,13H2,1-2H3,(H,30,31) |
| InChIKey | ABTDITZIMWVREP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|