C19H16ClN3O2S — CID 99796353
1-[(3R)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 99796353) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is 1-[(3R)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[(3R)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 99796353 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 1-[(3R)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | COc1cccc2cc([C@H]3CC(c4cccs4)=NN3C(C)=O)c(Cl)nc12 |
| InChI | InChI=1S/C19H16ClN3O2S/c1-11(24)23-15(10-14(22-23)17-7-4-8-26-17)13-9-12-5-3-6-16(25-2)18(12)21-19(13)20/h3-9,15H,10H2,1-2H3/t15-/m1/s1 |
| InChIKey | FIOPKCKLIVGWQS-OAHLLOKOSA-N |
| XLogP | 4.66 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|