C21H18ClN3O3S — CID 4205112
5-[3-(2-chloroquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid (PubChem CID 4205112) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is 5-[3-(2-chloroquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-[3-(2-chloroquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 4205112 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 5-[3-(2-chloroquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)N1N=C(c2cccs2)CC1c1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C21H18ClN3O3S/c22-21-14(11-13-5-1-2-6-15(13)23-21)17-12-16(18-7-4-10-29-18)24-25(17)19(26)8-3-9-20(27)28/h1-2,4-7,10-11,17H,3,8-9,12H2,(H,27,28) |
| InChIKey | ZIXGVAKUHBOTFU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|