C22H16ClN3OS2 — CID 3811140
[3-(2-chloro-6-methylquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-thiophen-2-ylmethanone (PubChem CID 3811140) has the molecular formula C22H16ClN3OS2 and a molecular weight of 437.98 g/mol. Its IUPAC name is [3-(2-chloro-6-methylquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-thiophen-2-ylmethanone.
| Compound Name | [3-(2-chloro-6-methylquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 3811140 |
| Molecular Formula | C22H16ClN3OS2 |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | [3-(2-chloro-6-methylquinolin-3-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-thiophen-2-ylmethanone |
| SMILES | Cc1ccc2nc(Cl)c(C3CC(c4cccs4)=NN3C(=O)c3cccs3)cc2c1 |
| InChI | InChI=1S/C22H16ClN3OS2/c1-13-6-7-16-14(10-13)11-15(21(23)24-16)18-12-17(19-4-2-8-28-19)25-26(18)22(27)20-5-3-9-29-20/h2-11,18H,12H2,1H3 |
| InChIKey | YUIOHYBZNMRMFV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|