C18H15N7S2 — CID 155540679
3-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 155540679) has the molecular formula C18H15N7S2 and a molecular weight of 393.50 g/mol. Its IUPAC name is 3-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 155540679 |
| Molecular Formula | C18H15N7S2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc2c(c1)cc(C1CC(c3cccs3)=NN1C(N)=S)c1nnnn12 |
| InChI | InChI=1S/C18H15N7S2/c1-10-4-5-14-11(7-10)8-12(17-20-22-23-24(14)17)15-9-13(16-3-2-6-27-16)21-25(15)18(19)26/h2-8,15H,9H2,1H3,(H2,19,26) |
| InChIKey | XUGPXNKFWBAPDL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|