C15H13N3O2S2 — CID 94036582
(3R)-3-(1,3-benzodioxol-5-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 94036582) has the molecular formula C15H13N3O2S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3R)-3-(1,3-benzodioxol-5-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3R)-3-(1,3-benzodioxol-5-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 94036582 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (3R)-3-(1,3-benzodioxol-5-yl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2cccs2)C[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13N3O2S2/c16-15(21)18-11(7-10(17-18)14-2-1-5-22-14)9-3-4-12-13(6-9)20-8-19-12/h1-6,11H,7-8H2,(H2,16,21)/t11-/m1/s1 |
| InChIKey | MHCIYGXQHRUCCN-LLVKDONJSA-N |
| XLogP | 2.87 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|