About 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole
3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole (PubChem CID 3163685) has the molecular formula C15H14N2O4S2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole |
| PubChem CID | 3163685 |
| Molecular Formula | C15H14N2O4S2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole |
| SMILES | CS(=O)(=O)N1N=C(c2cccs2)CC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14N2O4S2/c1-23(18,19)17-12(8-11(16-17)15-3-2-6-22-15)10-4-5-13-14(7-10)21-9-20-13/h2-7,12H,8-9H2,1H3 |
| InChIKey | VJJMQGYXWWHFKD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole (CID 3163685) is 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole is CS(=O)(=O)N1N=C(c2cccs2)CC1c1ccc2c(c1)OCO2.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole?
The InChIKey is VJJMQGYXWWHFKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O4S2/c1-23(18,19)17-12(8-11(16-17)15-3-2-6-22-15)10-4-5-13-14(7-10)21-9-20-13/h2-7,12H,8-9H2,1H3.
What are the key properties of 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole?
3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole has a molecular weight of 350.42 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-2-methylsulfonyl-5-thiophen-2-yl-3,4-dihydropyrazole is sourced from PubChem (CID 3163685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).