C14H13N3S2 — CID 50998327
3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 50998327) has the molecular formula C14H13N3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 50998327 |
| Molecular Formula | C14H13N3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-phenyl-5-thiophen-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2cccs2)CC1c1ccccc1 |
| InChI | InChI=1S/C14H13N3S2/c15-14(18)17-12(10-5-2-1-3-6-10)9-11(16-17)13-7-4-8-19-13/h1-8,12H,9H2,(H2,15,18) |
| InChIKey | BIKIMXKMVLLSSR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|