C19H19N3S — CID 5472130
5-(2,3-dihydro-1H-inden-5-yl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 5472130) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 5472130 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2ccc3c(c2)CCC3)CC1c1ccccc1 |
| InChI | InChI=1S/C19H19N3S/c20-19(23)22-18(14-5-2-1-3-6-14)12-17(21-22)16-10-9-13-7-4-8-15(13)11-16/h1-3,5-6,9-11,18H,4,7-8,12H2,(H2,20,23) |
| InChIKey | UOFGGXWLFXZHLA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|