C16H13Br2N3OS — CID 46842921
5-(3,4-dibromophenyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 46842921) has the molecular formula C16H13Br2N3OS and a molecular weight of 455.18 g/mol. Its IUPAC name is 5-(3,4-dibromophenyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(3,4-dibromophenyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 46842921 |
| Molecular Formula | C16H13Br2N3OS |
| Molecular Weight | 455.18 g/mol |
| Exact Mass | 452.91 |
| IUPAC Name | 5-(3,4-dibromophenyl)-3-(4-hydroxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2ccc(Br)c(Br)c2)CC1c1ccc(O)cc1 |
| InChI | InChI=1S/C16H13Br2N3OS/c17-12-6-3-10(7-13(12)18)14-8-15(21(20-14)16(19)23)9-1-4-11(22)5-2-9/h1-7,15,22H,8H2,(H2,19,23) |
| InChIKey | YXHJKERWOOIPRU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|