C17H16FN3O2S2 — CID 50906489
3-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 50906489) has the molecular formula C17H16FN3O2S2 and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 50906489 |
| Molecular Formula | C17H16FN3O2S2 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CS(=O)(=O)c1ccc(C2=NN(C(N)=S)C(c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C17H16FN3O2S2/c1-25(22,23)14-8-4-11(5-9-14)15-10-16(21(20-15)17(19)24)12-2-6-13(18)7-3-12/h2-9,16H,10H2,1H3,(H2,19,24) |
| InChIKey | HKZUQQZYMINJRP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|