C18H17ClN2O2S2 — CID 50925502
1-[3-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazol-2-yl]ethanethione (PubChem CID 50925502) has the molecular formula C18H17ClN2O2S2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazol-2-yl]ethanethione.
| Compound Name | 1-[3-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazol-2-yl]ethanethione |
|---|---|
| PubChem CID | 50925502 |
| Molecular Formula | C18H17ClN2O2S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-3,4-dihydropyrazol-2-yl]ethanethione |
| SMILES | CC(=S)N1N=C(c2ccc(S(C)(=O)=O)cc2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O2S2/c1-12(24)21-18(14-3-7-15(19)8-4-14)11-17(20-21)13-5-9-16(10-6-13)25(2,22)23/h3-10,18H,11H2,1-2H3 |
| InChIKey | HBRQLZNCICKNLQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|