C16H13ClFN3S — CID 139085278
(3R)-5-(4-chlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 139085278) has the molecular formula C16H13ClFN3S and a molecular weight of 333.82 g/mol. Its IUPAC name is (3R)-5-(4-chlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3R)-5-(4-chlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 139085278 |
| Molecular Formula | C16H13ClFN3S |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (3R)-5-(4-chlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2ccc(Cl)cc2)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13ClFN3S/c17-12-5-1-10(2-6-12)14-9-15(21(20-14)16(19)22)11-3-7-13(18)8-4-11/h1-8,15H,9H2,(H2,19,22)/t15-/m1/s1 |
| InChIKey | YMWVSFOVYFSNAO-OAHLLOKOSA-N |
| XLogP | 3.87 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|