C16H14ClN3O — CID 101242618
(3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 101242618) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is (3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | (3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 101242618 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (3S)-5-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | NC(=O)N1N=C(c2ccc(Cl)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H14ClN3O/c17-13-8-6-11(7-9-13)14-10-15(20(19-14)16(18)21)12-4-2-1-3-5-12/h1-9,15H,10H2,(H2,18,21)/t15-/m0/s1 |
| InChIKey | BVBDZLFWOQGAJA-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |